C17H11F2NO — CID 7771728
N-(3,4-difluorophenyl)naphthalene-2-carboxamide (PubChem CID 7771728) has the molecular formula C17H11F2NO and a molecular weight of 283.28 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)naphthalene-2-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 7771728 |
| Molecular Formula | C17H11F2NO |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-(3,4-difluorophenyl)naphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H11F2NO/c18-15-8-7-14(10-16(15)19)20-17(21)13-6-5-11-3-1-2-4-12(11)9-13/h1-10H,(H,20,21) |
| InChIKey | DYDSIDFGGFATAA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |