C15H8F5NO4 — CID 28674815
2-hydroxy-3-methyl-5-[(2,3,4,5,6-pentafluorobenzoyl)amino]benzoic acid (PubChem CID 28674815) has the molecular formula C15H8F5NO4 and a molecular weight of 361.22 g/mol. Its IUPAC name is 2-hydroxy-3-methyl-5-[(2,3,4,5,6-pentafluorobenzoyl)amino]benzoic acid.
| Compound Name | 2-hydroxy-3-methyl-5-[(2,3,4,5,6-pentafluorobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 28674815 |
| Molecular Formula | C15H8F5NO4 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2-hydroxy-3-methyl-5-[(2,3,4,5,6-pentafluorobenzoyl)amino]benzoic acid |
| SMILES | Cc1cc(NC(=O)c2c(F)c(F)c(F)c(F)c2F)cc(C(=O)O)c1O |
| InChI | InChI=1S/C15H8F5NO4/c1-4-2-5(3-6(13(4)22)15(24)25)21-14(23)7-8(16)10(18)12(20)11(19)9(7)17/h2-3,22H,1H3,(H,21,23)(H,24,25) |
| InChIKey | JHHKALYEUCKVTR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|