C19H21NO6 — CID 28675077
5-[(3,5-diethoxybenzoyl)amino]-2-hydroxy-3-methylbenzoic acid (PubChem CID 28675077) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is 5-[(3,5-diethoxybenzoyl)amino]-2-hydroxy-3-methylbenzoic acid.
| Compound Name | 5-[(3,5-diethoxybenzoyl)amino]-2-hydroxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 28675077 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 5-[(3,5-diethoxybenzoyl)amino]-2-hydroxy-3-methylbenzoic acid |
| SMILES | CCOc1cc(OCC)cc(C(=O)Nc2cc(C)c(O)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C19H21NO6/c1-4-25-14-7-12(8-15(10-14)26-5-2)18(22)20-13-6-11(3)17(21)16(9-13)19(23)24/h6-10,21H,4-5H2,1-3H3,(H,20,22)(H,23,24) |
| InChIKey | LWGGJLSUSLELTG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|