C15H11BrClNO4 — CID 28667958
5-[(5-bromo-2-chlorobenzoyl)amino]-2-hydroxy-3-methylbenzoic acid (PubChem CID 28667958) has the molecular formula C15H11BrClNO4 and a molecular weight of 384.61 g/mol. Its IUPAC name is 5-[(5-bromo-2-chlorobenzoyl)amino]-2-hydroxy-3-methylbenzoic acid.
| Compound Name | 5-[(5-bromo-2-chlorobenzoyl)amino]-2-hydroxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 28667958 |
| Molecular Formula | C15H11BrClNO4 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 5-[(5-bromo-2-chlorobenzoyl)amino]-2-hydroxy-3-methylbenzoic acid |
| SMILES | Cc1cc(NC(=O)c2cc(Br)ccc2Cl)cc(C(=O)O)c1O |
| InChI | InChI=1S/C15H11BrClNO4/c1-7-4-9(6-11(13(7)19)15(21)22)18-14(20)10-5-8(16)2-3-12(10)17/h2-6,19H,1H3,(H,18,20)(H,21,22) |
| InChIKey | XLKNJBVVKXNNJJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|