C17H15BrN2O5S — CID 28687761
5-[(5-bromo-2-methoxybenzoyl)carbamothioylamino]-2-hydroxy-3-methylbenzoic acid (PubChem CID 28687761) has the molecular formula C17H15BrN2O5S and a molecular weight of 439.29 g/mol. Its IUPAC name is 5-[(5-bromo-2-methoxybenzoyl)carbamothioylamino]-2-hydroxy-3-methylbenzoic acid.
| Compound Name | 5-[(5-bromo-2-methoxybenzoyl)carbamothioylamino]-2-hydroxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 28687761 |
| Molecular Formula | C17H15BrN2O5S |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 5-[(5-bromo-2-methoxybenzoyl)carbamothioylamino]-2-hydroxy-3-methylbenzoic acid |
| SMILES | COc1ccc(Br)cc1C(=O)NC(=S)Nc1cc(C)c(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H15BrN2O5S/c1-8-5-10(7-12(14(8)21)16(23)24)19-17(26)20-15(22)11-6-9(18)3-4-13(11)25-2/h3-7,21H,1-2H3,(H,23,24)(H2,19,20,22,26) |
| InChIKey | YTGLMNKVQDEJEV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|