C15H7BrClF6NO — CID 2268598
N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-chlorobenzamide (PubChem CID 2268598) has the molecular formula C15H7BrClF6NO and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-chlorobenzamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-chlorobenzamide |
|---|---|
| PubChem CID | 2268598 |
| Molecular Formula | C15H7BrClF6NO |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 444.93 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-chlorobenzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C15H7BrClF6NO/c16-9-1-2-12(17)11(6-9)13(25)24-10-4-7(14(18,19)20)3-8(5-10)15(21,22)23/h1-6H,(H,24,25) |
| InChIKey | ZGIOUSZKVBAGCD-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |