C15H10BrClF3NO2 — CID 34378925
5-bromo-2-chloro-N-[3-(2,2,2-trifluoroethoxy)phenyl]benzamide (PubChem CID 34378925) has the molecular formula C15H10BrClF3NO2 and a molecular weight of 408.60 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[3-(2,2,2-trifluoroethoxy)phenyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[3-(2,2,2-trifluoroethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 34378925 |
| Molecular Formula | C15H10BrClF3NO2 |
| Molecular Weight | 408.60 g/mol |
| Exact Mass | 406.95 |
| IUPAC Name | 5-bromo-2-chloro-N-[3-(2,2,2-trifluoroethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(OCC(F)(F)F)c1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C15H10BrClF3NO2/c16-9-4-5-13(17)12(6-9)14(22)21-10-2-1-3-11(7-10)23-8-15(18,19)20/h1-7H,8H2,(H,21,22) |
| InChIKey | PWHVMQXPTISPMX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |