C19H15F3N2O2 — CID 86981159
2-methyl-N-[3-(2,2,2-trifluoroethoxy)phenyl]quinoline-3-carboxamide (PubChem CID 86981159) has the molecular formula C19H15F3N2O2 and a molecular weight of 360.34 g/mol. Its IUPAC name is 2-methyl-N-[3-(2,2,2-trifluoroethoxy)phenyl]quinoline-3-carboxamide.
| Compound Name | 2-methyl-N-[3-(2,2,2-trifluoroethoxy)phenyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 86981159 |
| Molecular Formula | C19H15F3N2O2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-methyl-N-[3-(2,2,2-trifluoroethoxy)phenyl]quinoline-3-carboxamide |
| SMILES | Cc1nc2ccccc2cc1C(=O)Nc1cccc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F3N2O2/c1-12-16(9-13-5-2-3-8-17(13)23-12)18(25)24-14-6-4-7-15(10-14)26-11-19(20,21)22/h2-10H,11H2,1H3,(H,24,25) |
| InChIKey | SXKHCGRMNRBLDZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |