C17H12F3N3O — CID 118986422
2-amino-N-[3-(trifluoromethyl)phenyl]quinoline-3-carboxamide (PubChem CID 118986422) has the molecular formula C17H12F3N3O and a molecular weight of 331.30 g/mol. Its IUPAC name is 2-amino-N-[3-(trifluoromethyl)phenyl]quinoline-3-carboxamide.
| Compound Name | 2-amino-N-[3-(trifluoromethyl)phenyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 118986422 |
| Molecular Formula | C17H12F3N3O |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-amino-N-[3-(trifluoromethyl)phenyl]quinoline-3-carboxamide |
| SMILES | Nc1nc2ccccc2cc1C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F3N3O/c18-17(19,20)11-5-3-6-12(9-11)22-16(24)13-8-10-4-1-2-7-14(10)23-15(13)21/h1-9H,(H2,21,23)(H,22,24) |
| InChIKey | KWAUFDAWJMJKMP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |