About (3-acetamidophenyl) 5-bromo-2-chlorobenzoate
(3-acetamidophenyl) 5-bromo-2-chlorobenzoate (PubChem CID 5202414) has the molecular formula C15H11BrClNO3
and a molecular weight of 368.61 g/mol. Its IUPAC name is (3-acetamidophenyl) 5-bromo-2-chlorobenzoate.
Molecular Properties
| Compound Name | (3-acetamidophenyl) 5-bromo-2-chlorobenzoate |
| PubChem CID | 5202414 |
| Molecular Formula | C15H11BrClNO3 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | (3-acetamidophenyl) 5-bromo-2-chlorobenzoate |
| SMILES | CC(=O)Nc1cccc(OC(=O)c2cc(Br)ccc2Cl)c1 |
| InChI | InChI=1S/C15H11BrClNO3/c1-9(19)18-11-3-2-4-12(8-11)21-15(20)13-7-10(16)5-6-14(13)17/h2-8H,1H3,(H,18,19) |
| InChIKey | WGSCOHKDTGWDRR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-acetamidophenyl) 5-bromo-2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetamidophenyl) 5-bromo-2-chlorobenzoate?
The IUPAC name of (3-acetamidophenyl) 5-bromo-2-chlorobenzoate (CID 5202414) is (3-acetamidophenyl) 5-bromo-2-chlorobenzoate.
What is the SMILES notation for (3-acetamidophenyl) 5-bromo-2-chlorobenzoate?
The canonical SMILES for (3-acetamidophenyl) 5-bromo-2-chlorobenzoate is CC(=O)Nc1cccc(OC(=O)c2cc(Br)ccc2Cl)c1.
What is the InChIKey of (3-acetamidophenyl) 5-bromo-2-chlorobenzoate?
The InChIKey is WGSCOHKDTGWDRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrClNO3/c1-9(19)18-11-3-2-4-12(8-11)21-15(20)13-7-10(16)5-6-14(13)17/h2-8H,1H3,(H,18,19).
What are the key properties of (3-acetamidophenyl) 5-bromo-2-chlorobenzoate?
(3-acetamidophenyl) 5-bromo-2-chlorobenzoate has a molecular weight of 368.61 g/mol, XLogP of 4.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetamidophenyl) 5-bromo-2-chlorobenzoate is sourced from PubChem (CID 5202414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).