About (4-chlorophenyl) 3-acetamidobenzoate
(4-chlorophenyl) 3-acetamidobenzoate (PubChem CID 47098149) has the molecular formula C15H12ClNO3
and a molecular weight of 289.72 g/mol. Its IUPAC name is (4-chlorophenyl) 3-acetamidobenzoate.
Molecular Properties
| Compound Name | (4-chlorophenyl) 3-acetamidobenzoate |
| PubChem CID | 47098149 |
| Molecular Formula | C15H12ClNO3 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | (4-chlorophenyl) 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1cccc(C(=O)Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C15H12ClNO3/c1-10(18)17-13-4-2-3-11(9-13)15(19)20-14-7-5-12(16)6-8-14/h2-9H,1H3,(H,17,18) |
| InChIKey | XDANOMOTRRADOS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) 3-acetamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) 3-acetamidobenzoate?
The IUPAC name of (4-chlorophenyl) 3-acetamidobenzoate (CID 47098149) is (4-chlorophenyl) 3-acetamidobenzoate.
What is the SMILES notation for (4-chlorophenyl) 3-acetamidobenzoate?
The canonical SMILES for (4-chlorophenyl) 3-acetamidobenzoate is CC(=O)Nc1cccc(C(=O)Oc2ccc(Cl)cc2)c1.
What is the InChIKey of (4-chlorophenyl) 3-acetamidobenzoate?
The InChIKey is XDANOMOTRRADOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClNO3/c1-10(18)17-13-4-2-3-11(9-13)15(19)20-14-7-5-12(16)6-8-14/h2-9H,1H3,(H,17,18).
What are the key properties of (4-chlorophenyl) 3-acetamidobenzoate?
(4-chlorophenyl) 3-acetamidobenzoate has a molecular weight of 289.72 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) 3-acetamidobenzoate is sourced from PubChem (CID 47098149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).