About [2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate
[2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate (PubChem CID 7950588) has the molecular formula C17H13BrClNO4
and a molecular weight of 410.65 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate.
Molecular Properties
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate |
| PubChem CID | 7950588 |
| Molecular Formula | C17H13BrClNO4 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 408.97 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate |
| SMILES | CC(=O)c1cccc(NC(=O)COC(=O)c2cc(Br)ccc2Cl)c1 |
| InChI | InChI=1S/C17H13BrClNO4/c1-10(21)11-3-2-4-13(7-11)20-16(22)9-24-17(23)14-8-12(18)5-6-15(14)19/h2-8H,9H2,1H3,(H,20,22) |
| InChIKey | PTBKBEQJKCZYIO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate?
The IUPAC name of [2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate (CID 7950588) is [2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate.
What is the SMILES notation for [2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate?
The canonical SMILES for [2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate is CC(=O)c1cccc(NC(=O)COC(=O)c2cc(Br)ccc2Cl)c1.
What is the InChIKey of [2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate?
The InChIKey is PTBKBEQJKCZYIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrClNO4/c1-10(21)11-3-2-4-13(7-11)20-16(22)9-24-17(23)14-8-12(18)5-6-15(14)19/h2-8H,9H2,1H3,(H,20,22).
What are the key properties of [2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate?
[2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate has a molecular weight of 410.65 g/mol, XLogP of 4.10, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-acetylanilino)-2-oxoethyl] 5-bromo-2-chlorobenzoate is sourced from PubChem (CID 7950588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).