C17H12Cl3NO4 — CID 2339779
[2-(3-acetylanilino)-2-oxoethyl] 2,3,6-trichlorobenzoate (PubChem CID 2339779) has the molecular formula C17H12Cl3NO4 and a molecular weight of 400.65 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl] 2,3,6-trichlorobenzoate.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 2339779 |
| Molecular Formula | C17H12Cl3NO4 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl] 2,3,6-trichlorobenzoate |
| SMILES | CC(=O)c1cccc(NC(=O)COC(=O)c2c(Cl)ccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C17H12Cl3NO4/c1-9(22)10-3-2-4-11(7-10)21-14(23)8-25-17(24)15-12(18)5-6-13(19)16(15)20/h2-7H,8H2,1H3,(H,21,23) |
| InChIKey | ZTNFYEILXRXMHV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|