C16H11BrCl3NO3 — CID 2397397
[2-(4-bromo-3-methylanilino)-2-oxoethyl] 2,3,6-trichlorobenzoate (PubChem CID 2397397) has the molecular formula C16H11BrCl3NO3 and a molecular weight of 451.53 g/mol. Its IUPAC name is [2-(4-bromo-3-methylanilino)-2-oxoethyl] 2,3,6-trichlorobenzoate.
| Compound Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 2397397 |
| Molecular Formula | C16H11BrCl3NO3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 448.90 |
| IUPAC Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] 2,3,6-trichlorobenzoate |
| SMILES | Cc1cc(NC(=O)COC(=O)c2c(Cl)ccc(Cl)c2Cl)ccc1Br |
| InChI | InChI=1S/C16H11BrCl3NO3/c1-8-6-9(2-3-10(8)17)21-13(22)7-24-16(23)14-11(18)4-5-12(19)15(14)20/h2-6H,7H2,1H3,(H,21,22) |
| InChIKey | VVNPXDPFGKJBMP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|