C19H19NO4 — CID 2336326
[2-(3-acetylanilino)-2-oxoethyl] 2,5-dimethylbenzoate (PubChem CID 2336326) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl] 2,5-dimethylbenzoate.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl] 2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 2336326 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl] 2,5-dimethylbenzoate |
| SMILES | CC(=O)c1cccc(NC(=O)COC(=O)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C19H19NO4/c1-12-7-8-13(2)17(9-12)19(23)24-11-18(22)20-16-6-4-5-15(10-16)14(3)21/h4-10H,11H2,1-3H3,(H,20,22) |
| InChIKey | NDOVIUISVJDQGG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |