[2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate

C18H18N2O4 — CID 8803821

IUPAC[2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate
SMILESCc1ccc(C)c(C(=O)COC(=O)c2cccc(NC(N)=O)c2)c1
InChIInChI=1S/C18H18N2O4/c1-11-6-7-12(2)15(8-11)16(21)10-24-17(22)13-4-3-5-14(9-13)20-18(19)23/h3-9H,10H2,1-2H3,(H3,19,20,23)
InChIKeyJNWQJWFRDXSFJZ-UHFFFAOYSA-N
MW326.35 g/mol
LogP2.83
Rot. Bonds5

About [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate

[2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate (PubChem CID 8803821) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate.

Molecular Properties

Compound Name[2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate
PubChem CID8803821
Molecular FormulaC18H18N2O4
Molecular Weight326.35 g/mol
Exact Mass326.13
IUPAC Name[2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate
SMILESCc1ccc(C)c(C(=O)COC(=O)c2cccc(NC(N)=O)c2)c1
InChIInChI=1S/C18H18N2O4/c1-11-6-7-12(2)15(8-11)16(21)10-24-17(22)13-4-3-5-14(9-13)20-18(19)23/h3-9H,10H2,1-2H3,(H3,19,20,23)
InChIKeyJNWQJWFRDXSFJZ-UHFFFAOYSA-N
XLogP2.83
TPSA98.49 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.35
LogP ≤ 52.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate?
The IUPAC name of [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate (CID 8803821) is [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate.
What is the SMILES notation for [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate?
The canonical SMILES for [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate is Cc1ccc(C)c(C(=O)COC(=O)c2cccc(NC(N)=O)c2)c1.
What is the InChIKey of [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate?
The InChIKey is JNWQJWFRDXSFJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O4/c1-11-6-7-12(2)15(8-11)16(21)10-24-17(22)13-4-3-5-14(9-13)20-18(19)23/h3-9H,10H2,1-2H3,(H3,19,20,23).
What are the key properties of [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate?
[2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate has a molecular weight of 326.35 g/mol, XLogP of 2.83, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-(carbamoylamino)benzoate is sourced from PubChem (CID 8803821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).