C16H16N2O2 — CID 17394434
N-(3-carbamoylphenyl)-2,5-dimethylbenzamide (PubChem CID 17394434) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(3-carbamoylphenyl)-2,5-dimethylbenzamide.
| Compound Name | N-(3-carbamoylphenyl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 17394434 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-(3-carbamoylphenyl)-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)Nc2cccc(C(N)=O)c2)c1 |
| InChI | InChI=1S/C16H16N2O2/c1-10-6-7-11(2)14(8-10)16(20)18-13-5-3-4-12(9-13)15(17)19/h3-9H,1-2H3,(H2,17,19)(H,18,20) |
| InChIKey | VBWVFKNZOYDTMZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |