C18H18ClNO5 — CID 28675057
2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid (PubChem CID 28675057) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid.
| Compound Name | 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 28675057 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid |
| SMILES | CCOc1cc(OCC)cc(C(=O)Nc2ccc(C(=O)O)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H18ClNO5/c1-3-24-13-7-11(8-14(10-13)25-4-2)17(21)20-12-5-6-15(18(22)23)16(19)9-12/h5-10H,3-4H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | OECPBPCMTRNYKP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |