2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid

C18H18ClNO5 — CID 28675057

IUPAC2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid
SMILESCCOc1cc(OCC)cc(C(=O)Nc2ccc(C(=O)O)c(Cl)c2)c1
InChIInChI=1S/C18H18ClNO5/c1-3-24-13-7-11(8-14(10-13)25-4-2)17(21)20-12-5-6-15(18(22)23)16(19)9-12/h5-10H,3-4H2,1-2H3,(H,20,21)(H,22,23)
InChIKeyOECPBPCMTRNYKP-UHFFFAOYSA-N
MW363.80 g/mol
LogP4.09
Rot. Bonds7

About 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid

2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid (PubChem CID 28675057) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid.

Molecular Properties

Compound Name2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid
PubChem CID28675057
Molecular FormulaC18H18ClNO5
Molecular Weight363.80 g/mol
Exact Mass363.09
IUPAC Name2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid
SMILESCCOc1cc(OCC)cc(C(=O)Nc2ccc(C(=O)O)c(Cl)c2)c1
InChIInChI=1S/C18H18ClNO5/c1-3-24-13-7-11(8-14(10-13)25-4-2)17(21)20-12-5-6-15(18(22)23)16(19)9-12/h5-10H,3-4H2,1-2H3,(H,20,21)(H,22,23)
InChIKeyOECPBPCMTRNYKP-UHFFFAOYSA-N
XLogP4.09
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.80
LogP ≤ 54.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid?
The IUPAC name of 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid (CID 28675057) is 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid.
What is the SMILES notation for 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid?
The canonical SMILES for 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid is CCOc1cc(OCC)cc(C(=O)Nc2ccc(C(=O)O)c(Cl)c2)c1.
What is the InChIKey of 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid?
The InChIKey is OECPBPCMTRNYKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClNO5/c1-3-24-13-7-11(8-14(10-13)25-4-2)17(21)20-12-5-6-15(18(22)23)16(19)9-12/h5-10H,3-4H2,1-2H3,(H,20,21)(H,22,23).
What are the key properties of 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid?
2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid has a molecular weight of 363.80 g/mol, XLogP of 4.09, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[(3,5-diethoxybenzoyl)amino]benzoic acid is sourced from PubChem (CID 28675057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).