C9H10FNO2 — CID 175535904
(4-fluoro-3,5-dimethylphenyl)carbamic acid (PubChem CID 175535904) has the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. Its IUPAC name is (4-fluoro-3,5-dimethylphenyl)carbamic acid.
| Compound Name | (4-fluoro-3,5-dimethylphenyl)carbamic acid |
|---|---|
| PubChem CID | 175535904 |
| Molecular Formula | C9H10FNO2 |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | (4-fluoro-3,5-dimethylphenyl)carbamic acid |
| SMILES | Cc1cc(NC(=O)O)cc(C)c1F |
| InChI | InChI=1S/C9H10FNO2/c1-5-3-7(11-9(12)13)4-6(2)8(5)10/h3-4,11H,1-2H3,(H,12,13) |
| InChIKey | UTBVVOSRVHJECQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |