C13H22CeNO4 — CID 162487777
carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid (PubChem CID 162487777) has the molecular formula C13H22CeNO4 and a molecular weight of 396.44 g/mol. Its IUPAC name is carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid.
| Compound Name | carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid |
|---|---|
| PubChem CID | 162487777 |
| Molecular Formula | C13H22CeNO4 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid |
| SMILES | COc1cc(NC(=O)O)cc(OC)c1C.[CH3-].[CH3-].[CH3-].[Ce+3] |
| InChI | InChI=1S/C10H13NO4.3CH3.Ce/c1-6-8(14-2)4-7(11-10(12)13)5-9(6)15-3;;;;/h4-5,11H,1-3H3,(H,12,13);3*1H3;/q;3*-1;+3 |
| InChIKey | NGXJNQUMJOCMRD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|