About carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid
carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid (PubChem CID 162487777) has the molecular formula C13H22CeNO4
and a molecular weight of 396.44 g/mol. Its IUPAC name is carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid.
Molecular Properties
| Compound Name | carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid |
| PubChem CID | 162487777 |
| Molecular Formula | C13H22CeNO4 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid |
| SMILES | COc1cc(NC(=O)O)cc(OC)c1C.[CH3-].[CH3-].[CH3-].[Ce+3] |
| InChI | InChI=1S/C10H13NO4.3CH3.Ce/c1-6-8(14-2)4-7(11-10(12)13)5-9(6)15-3;;;;/h4-5,11H,1-3H3,(H,12,13);3*1H3;/q;3*-1;+3 |
| InChIKey | NGXJNQUMJOCMRD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid?
The IUPAC name of carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid (CID 162487777) is carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid.
What is the SMILES notation for carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid?
The canonical SMILES for carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid is COc1cc(NC(=O)O)cc(OC)c1C.[CH3-].[CH3-].[CH3-].[Ce+3].
What is the InChIKey of carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid?
The InChIKey is NGXJNQUMJOCMRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4.3CH3.Ce/c1-6-8(14-2)4-7(11-10(12)13)5-9(6)15-3;;;;/h4-5,11H,1-3H3,(H,12,13);3*1H3;/q;3*-1;+3.
What are the key properties of carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid?
carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid has a molecular weight of 396.44 g/mol, XLogP of 3.45, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;cerium(3+);(3,5-dimethoxy-4-methylphenyl)carbamic acid is sourced from PubChem (CID 162487777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).