C10H14O2 — CID 524839
1,3-dimethoxy-2,5-dimethylbenzene (PubChem CID 524839) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 1,3-dimethoxy-2,5-dimethylbenzene.
| Compound Name | 1,3-dimethoxy-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 524839 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1,3-dimethoxy-2,5-dimethylbenzene |
| SMILES | COc1cc(C)cc(OC)c1C |
| InChI | InChI=1S/C10H14O2/c1-7-5-9(11-3)8(2)10(6-7)12-4/h5-6H,1-4H3 |
| InChIKey | GIUXLBFXMAOOQJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |