C12H20O5Si — CID 59566599
(3,5-dimethoxy-4-methylphenyl)-trimethoxysilane (PubChem CID 59566599) has the molecular formula C12H20O5Si and a molecular weight of 272.37 g/mol. Its IUPAC name is (3,5-dimethoxy-4-methylphenyl)-trimethoxysilane.
| Compound Name | (3,5-dimethoxy-4-methylphenyl)-trimethoxysilane |
|---|---|
| PubChem CID | 59566599 |
| Molecular Formula | C12H20O5Si |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | (3,5-dimethoxy-4-methylphenyl)-trimethoxysilane |
| SMILES | COc1cc([Si](OC)(OC)OC)cc(OC)c1C |
| InChI | InChI=1S/C12H20O5Si/c1-9-11(13-2)7-10(8-12(9)14-3)18(15-4,16-5)17-6/h7-8H,1-6H3 |
| InChIKey | OSHKUXJICWOVQT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|