C9H12O2S2 — CID 123867594
5-(disulfanyl)-1,3-dimethoxy-2-methylbenzene (PubChem CID 123867594) has the molecular formula C9H12O2S2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 5-(disulfanyl)-1,3-dimethoxy-2-methylbenzene.
| Compound Name | 5-(disulfanyl)-1,3-dimethoxy-2-methylbenzene |
|---|---|
| PubChem CID | 123867594 |
| Molecular Formula | C9H12O2S2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 5-(disulfanyl)-1,3-dimethoxy-2-methylbenzene |
| SMILES | COc1cc(SS)cc(OC)c1C |
| InChI | InChI=1S/C9H12O2S2/c1-6-8(10-2)4-7(13-12)5-9(6)11-3/h4-5,12H,1-3H3 |
| InChIKey | UQBODCHEULWWMG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|