C11H14O3 — CID 118998759
2-(3-methoxy-2,5-dimethylphenyl)acetic acid (PubChem CID 118998759) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-(3-methoxy-2,5-dimethylphenyl)acetic acid.
| Compound Name | 2-(3-methoxy-2,5-dimethylphenyl)acetic acid |
|---|---|
| PubChem CID | 118998759 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-(3-methoxy-2,5-dimethylphenyl)acetic acid |
| SMILES | COc1cc(C)cc(CC(=O)O)c1C |
| InChI | InChI=1S/C11H14O3/c1-7-4-9(6-11(12)13)8(2)10(5-7)14-3/h4-5H,6H2,1-3H3,(H,12,13) |
| InChIKey | HGQCEHRSUNUNJK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |