C16H28O4Si — CID 59566922
triethoxy-[(3-methoxy-2,5-dimethylphenyl)methyl]silane (PubChem CID 59566922) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is triethoxy-[(3-methoxy-2,5-dimethylphenyl)methyl]silane.
| Compound Name | triethoxy-[(3-methoxy-2,5-dimethylphenyl)methyl]silane |
|---|---|
| PubChem CID | 59566922 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | triethoxy-[(3-methoxy-2,5-dimethylphenyl)methyl]silane |
| SMILES | CCO[Si](Cc1cc(C)cc(OC)c1C)(OCC)OCC |
| InChI | InChI=1S/C16H28O4Si/c1-7-18-21(19-8-2,20-9-3)12-15-10-13(4)11-16(17-6)14(15)5/h10-11H,7-9,12H2,1-6H3 |
| InChIKey | JNTXDNAQQIMBOH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|