About triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane
triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane (PubChem CID 59566722) has the molecular formula C16H28O4Si
and a molecular weight of 312.48 g/mol. Its IUPAC name is triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane.
Molecular Properties
| Compound Name | triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane |
| PubChem CID | 59566722 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane |
| SMILES | CCO[Si](Cc1cc(OC)c(C)cc1C)(OCC)OCC |
| InChI | InChI=1S/C16H28O4Si/c1-7-18-21(19-8-2,20-9-3)12-15-11-16(17-6)14(5)10-13(15)4/h10-11H,7-9,12H2,1-6H3 |
| InChIKey | TUGHFKZLJFGGPY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane?
The IUPAC name of triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane (CID 59566722) is triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane.
What is the SMILES notation for triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane?
The canonical SMILES for triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane is CCO[Si](Cc1cc(OC)c(C)cc1C)(OCC)OCC.
What is the InChIKey of triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane?
The InChIKey is TUGHFKZLJFGGPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4Si/c1-7-18-21(19-8-2,20-9-3)12-15-11-16(17-6)14(5)10-13(15)4/h10-11H,7-9,12H2,1-6H3.
What are the key properties of triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane?
triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane has a molecular weight of 312.48 g/mol, XLogP of 3.44, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxy-[(5-methoxy-2,4-dimethylphenyl)methyl]silane is sourced from PubChem (CID 59566722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).