C9H11IO3 — CID 163998630
(2,6-dimethoxy-4-methylphenyl) hypoiodite (PubChem CID 163998630) has the molecular formula C9H11IO3 and a molecular weight of 294.09 g/mol. Its IUPAC name is (2,6-dimethoxy-4-methylphenyl) hypoiodite.
| Compound Name | (2,6-dimethoxy-4-methylphenyl) hypoiodite |
|---|---|
| PubChem CID | 163998630 |
| Molecular Formula | C9H11IO3 |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | (2,6-dimethoxy-4-methylphenyl) hypoiodite |
| SMILES | COc1cc(C)cc(OC)c1OI |
| InChI | InChI=1S/C9H11IO3/c1-6-4-7(11-2)9(13-10)8(5-6)12-3/h4-5H,1-3H3 |
| InChIKey | UGYJBYWDYHFYLT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|