About CID 131844912
CID 131844912 (PubChem CID 131844912) has the molecular formula C8H9O2
and a molecular weight of 137.16 g/mol.
Molecular Properties
| Compound Name | CID 131844912 |
| PubChem CID | 131844912 |
| Molecular Formula | C8H9O2 |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | — |
| SMILES | COc1cc(C)ccc1[O] |
| InChI | InChI=1S/C8H9O2/c1-6-3-4-7(9)8(5-6)10-2/h3-5H,1-2H3 |
| InChIKey | MGTOXDSTANRCLF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 131844912 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131844912?
The IUPAC name of CID 131844912 (CID 131844912) is not available.
What is the SMILES notation for CID 131844912?
The canonical SMILES for CID 131844912 is COc1cc(C)ccc1[O].
What is the InChIKey of CID 131844912?
The InChIKey is MGTOXDSTANRCLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9O2/c1-6-3-4-7(9)8(5-6)10-2/h3-5H,1-2H3.
What are the key properties of CID 131844912?
CID 131844912 has a molecular weight of 137.16 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131844912 is sourced from PubChem (CID 131844912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).