About sodium;hydride;2-methoxy-4-methylphenol
sodium;hydride;2-methoxy-4-methylphenol (PubChem CID 174706082) has the molecular formula C8H11NaO2
and a molecular weight of 162.16 g/mol. Its IUPAC name is sodium;hydride;2-methoxy-4-methylphenol.
Molecular Properties
| Compound Name | sodium;hydride;2-methoxy-4-methylphenol |
| PubChem CID | 174706082 |
| Molecular Formula | C8H11NaO2 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | sodium;hydride;2-methoxy-4-methylphenol |
| SMILES | COc1cc(C)ccc1O.[H-].[Na+] |
| InChI | InChI=1S/C8H10O2.Na.H/c1-6-3-4-7(9)8(5-6)10-2;;/h3-5,9H,1-2H3;;/q;+1;-1 |
| InChIKey | NAHGMZNSZYVZOI-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;hydride;2-methoxy-4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-methoxy-4-methylphenol?
The IUPAC name of sodium;hydride;2-methoxy-4-methylphenol (CID 174706082) is sodium;hydride;2-methoxy-4-methylphenol.
What is the SMILES notation for sodium;hydride;2-methoxy-4-methylphenol?
The canonical SMILES for sodium;hydride;2-methoxy-4-methylphenol is COc1cc(C)ccc1O.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-methoxy-4-methylphenol?
The InChIKey is NAHGMZNSZYVZOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.Na.H/c1-6-3-4-7(9)8(5-6)10-2;;/h3-5,9H,1-2H3;;/q;+1;-1.
What are the key properties of sodium;hydride;2-methoxy-4-methylphenol?
sodium;hydride;2-methoxy-4-methylphenol has a molecular weight of 162.16 g/mol, XLogP of -1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-methoxy-4-methylphenol is sourced from PubChem (CID 174706082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).