About tris(2-hydroxy-5-methylphenyl) phosphite
tris(2-hydroxy-5-methylphenyl) phosphite (PubChem CID 101310923) has the molecular formula C21H21O6P
and a molecular weight of 400.37 g/mol. Its IUPAC name is tris(2-hydroxy-5-methylphenyl) phosphite.
Molecular Properties
| Compound Name | tris(2-hydroxy-5-methylphenyl) phosphite |
| PubChem CID | 101310923 |
| Molecular Formula | C21H21O6P |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | tris(2-hydroxy-5-methylphenyl) phosphite |
| SMILES | Cc1ccc(O)c(OP(Oc2cc(C)ccc2O)Oc2cc(C)ccc2O)c1 |
| InChI | InChI=1S/C21H21O6P/c1-13-4-7-16(22)19(10-13)25-28(26-20-11-14(2)5-8-17(20)23)27-21-12-15(3)6-9-18(21)24/h4-12,22-24H,1-3H3 |
| InChIKey | GLRJTWSEEFEPDJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(2-hydroxy-5-methylphenyl) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-hydroxy-5-methylphenyl) phosphite?
The IUPAC name of tris(2-hydroxy-5-methylphenyl) phosphite (CID 101310923) is tris(2-hydroxy-5-methylphenyl) phosphite.
What is the SMILES notation for tris(2-hydroxy-5-methylphenyl) phosphite?
The canonical SMILES for tris(2-hydroxy-5-methylphenyl) phosphite is Cc1ccc(O)c(OP(Oc2cc(C)ccc2O)Oc2cc(C)ccc2O)c1.
What is the InChIKey of tris(2-hydroxy-5-methylphenyl) phosphite?
The InChIKey is GLRJTWSEEFEPDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21O6P/c1-13-4-7-16(22)19(10-13)25-28(26-20-11-14(2)5-8-17(20)23)27-21-12-15(3)6-9-18(21)24/h4-12,22-24H,1-3H3.
What are the key properties of tris(2-hydroxy-5-methylphenyl) phosphite?
tris(2-hydroxy-5-methylphenyl) phosphite has a molecular weight of 400.37 g/mol, XLogP of 5.49, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-hydroxy-5-methylphenyl) phosphite is sourced from PubChem (CID 101310923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).