About bis(4-methylbenzene-1,2-diol);zirconium
bis(4-methylbenzene-1,2-diol);zirconium (PubChem CID 23558294) has the molecular formula C14H16O4Zr
and a molecular weight of 339.50 g/mol. Its IUPAC name is bis(4-methylbenzene-1,2-diol);zirconium.
Molecular Properties
| Compound Name | bis(4-methylbenzene-1,2-diol);zirconium |
| PubChem CID | 23558294 |
| Molecular Formula | C14H16O4Zr |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | bis(4-methylbenzene-1,2-diol);zirconium |
| SMILES | Cc1ccc(O)c(O)c1.Cc1ccc(O)c(O)c1.[Zr] |
| InChI | InChI=1S/2C7H8O2.Zr/c2*1-5-2-3-6(8)7(9)4-5;/h2*2-4,8-9H,1H3; |
| InChIKey | OESKTDBMGLMWKY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze bis(4-methylbenzene-1,2-diol);zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-methylbenzene-1,2-diol);zirconium?
The IUPAC name of bis(4-methylbenzene-1,2-diol);zirconium (CID 23558294) is bis(4-methylbenzene-1,2-diol);zirconium.
What is the SMILES notation for bis(4-methylbenzene-1,2-diol);zirconium?
The canonical SMILES for bis(4-methylbenzene-1,2-diol);zirconium is Cc1ccc(O)c(O)c1.Cc1ccc(O)c(O)c1.[Zr].
What is the InChIKey of bis(4-methylbenzene-1,2-diol);zirconium?
The InChIKey is OESKTDBMGLMWKY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8O2.Zr/c2*1-5-2-3-6(8)7(9)4-5;/h2*2-4,8-9H,1H3;.
What are the key properties of bis(4-methylbenzene-1,2-diol);zirconium?
bis(4-methylbenzene-1,2-diol);zirconium has a molecular weight of 339.50 g/mol, XLogP of 2.81, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-methylbenzene-1,2-diol);zirconium is sourced from PubChem (CID 23558294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).