C8H10OSm — CID 87732062
2,5-dimethylphenol;samarium (PubChem CID 87732062) has the molecular formula C8H10OSm and a molecular weight of 272.53 g/mol. Its IUPAC name is 2,5-dimethylphenol;samarium.
| Compound Name | 2,5-dimethylphenol;samarium |
|---|---|
| PubChem CID | 87732062 |
| Molecular Formula | C8H10OSm |
| Molecular Weight | 272.53 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 2,5-dimethylphenol;samarium |
| SMILES | Cc1ccc(C)c(O)c1.[Sm] |
| InChI | InChI=1S/C8H10O.Sm/c1-6-3-4-7(2)8(9)5-6;/h3-5,9H,1-2H3; |
| InChIKey | ZWZRSBWCPLJGAJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |