C14H15OSc- — CID 154258106
benzene;2,5-dimethylphenol;scandium (PubChem CID 154258106) has the molecular formula C14H15OSc- and a molecular weight of 244.23 g/mol. Its IUPAC name is benzene;2,5-dimethylphenol;scandium.
| Compound Name | benzene;2,5-dimethylphenol;scandium |
|---|---|
| PubChem CID | 154258106 |
| Molecular Formula | C14H15OSc- |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | benzene;2,5-dimethylphenol;scandium |
| SMILES | Cc1ccc(C)c(O)c1.[Sc].[c-]1ccccc1 |
| InChI | InChI=1S/C8H10O.C6H5.Sc/c1-6-3-4-7(2)8(9)5-6;1-2-4-6-5-3-1;/h3-5,9H,1-2H3;1-5H;/q;-1; |
| InChIKey | IOQDSXVAUFZMEZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|