About 1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol
1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol (PubChem CID 68551781) has the molecular formula C30H42O2
and a molecular weight of 434.66 g/mol. Its IUPAC name is 1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol.
Molecular Properties
| Compound Name | 1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol |
| PubChem CID | 68551781 |
| Molecular Formula | C30H42O2 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | 1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol |
| SMILES | Cc1ccc(C(C)C)c(O)c1.Cc1ccc(C(C)C)cc1.Cc1ccc(C(C)C)cc1O |
| InChI | InChI=1S/2C10H14O.C10H14/c1-7(2)9-5-4-8(3)10(11)6-9;1-7(2)9-5-4-8(3)6-10(9)11;1-8(2)10-6-4-9(3)5-7-10/h2*4-7,11H,1-3H3;4-8H,1-3H3 |
| InChIKey | GXNCMDVSIMLIJH-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol?
The IUPAC name of 1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol (CID 68551781) is 1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol.
What is the SMILES notation for 1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol?
The canonical SMILES for 1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol is Cc1ccc(C(C)C)c(O)c1.Cc1ccc(C(C)C)cc1.Cc1ccc(C(C)C)cc1O.
What is the InChIKey of 1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol?
The InChIKey is GXNCMDVSIMLIJH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H14O.C10H14/c1-7(2)9-5-4-8(3)10(11)6-9;1-7(2)9-5-4-8(3)6-10(9)11;1-8(2)10-6-4-9(3)5-7-10/h2*4-7,11H,1-3H3;4-8H,1-3H3.
What are the key properties of 1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol?
1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol has a molecular weight of 434.66 g/mol, XLogP of 8.77, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-propan-2-ylbenzene;2-methyl-5-propan-2-ylphenol;5-methyl-2-propan-2-ylphenol is sourced from PubChem (CID 68551781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).