C19H26O2 — CID 70978775
5-methyl-2-propan-2-ylphenol;2,3,6-trimethylphenol (PubChem CID 70978775) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 5-methyl-2-propan-2-ylphenol;2,3,6-trimethylphenol.
| Compound Name | 5-methyl-2-propan-2-ylphenol;2,3,6-trimethylphenol |
|---|---|
| PubChem CID | 70978775 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 5-methyl-2-propan-2-ylphenol;2,3,6-trimethylphenol |
| SMILES | Cc1ccc(C(C)C)c(O)c1.Cc1ccc(C)c(O)c1C |
| InChI | InChI=1S/C10H14O.C9H12O/c1-7(2)9-5-4-8(3)6-10(9)11;1-6-4-5-7(2)9(10)8(6)3/h4-7,11H,1-3H3;4-5,10H,1-3H3 |
| InChIKey | SIZUTSLYNPKXKY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |