About cobalt;bis(5-methyl-2-propan-2-ylphenol)
cobalt;bis(5-methyl-2-propan-2-ylphenol) (PubChem CID 156896903) has the molecular formula C20H28CoO2
and a molecular weight of 359.38 g/mol. Its IUPAC name is cobalt;bis(5-methyl-2-propan-2-ylphenol).
Molecular Properties
| Compound Name | cobalt;bis(5-methyl-2-propan-2-ylphenol) |
| PubChem CID | 156896903 |
| Molecular Formula | C20H28CoO2 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | cobalt;bis(5-methyl-2-propan-2-ylphenol) |
| SMILES | Cc1ccc(C(C)C)c(O)c1.Cc1ccc(C(C)C)c(O)c1.[Co] |
| InChI | InChI=1S/2C10H14O.Co/c2*1-7(2)9-5-4-8(3)6-10(9)11;/h2*4-7,11H,1-3H3; |
| InChIKey | XZSXGYYQRJXTJS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cobalt;bis(5-methyl-2-propan-2-ylphenol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(5-methyl-2-propan-2-ylphenol)?
The IUPAC name of cobalt;bis(5-methyl-2-propan-2-ylphenol) (CID 156896903) is cobalt;bis(5-methyl-2-propan-2-ylphenol).
What is the SMILES notation for cobalt;bis(5-methyl-2-propan-2-ylphenol)?
The canonical SMILES for cobalt;bis(5-methyl-2-propan-2-ylphenol) is Cc1ccc(C(C)C)c(O)c1.Cc1ccc(C(C)C)c(O)c1.[Co].
What is the InChIKey of cobalt;bis(5-methyl-2-propan-2-ylphenol)?
The InChIKey is XZSXGYYQRJXTJS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H14O.Co/c2*1-7(2)9-5-4-8(3)6-10(9)11;/h2*4-7,11H,1-3H3;.
What are the key properties of cobalt;bis(5-methyl-2-propan-2-ylphenol)?
cobalt;bis(5-methyl-2-propan-2-ylphenol) has a molecular weight of 359.38 g/mol, XLogP of 5.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(5-methyl-2-propan-2-ylphenol) is sourced from PubChem (CID 156896903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).