About 5-methyl-2-propan-2-ylphenol;octan-3-one
5-methyl-2-propan-2-ylphenol;octan-3-one (PubChem CID 69043830) has the molecular formula C18H30O2
and a molecular weight of 278.44 g/mol. Its IUPAC name is 5-methyl-2-propan-2-ylphenol;octan-3-one.
Molecular Properties
| Compound Name | 5-methyl-2-propan-2-ylphenol;octan-3-one |
| PubChem CID | 69043830 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 5-methyl-2-propan-2-ylphenol;octan-3-one |
| SMILES | CCCCCC(=O)CC.Cc1ccc(C(C)C)c(O)c1 |
| InChI | InChI=1S/C10H14O.C8H16O/c1-7(2)9-5-4-8(3)6-10(9)11;1-3-5-6-7-8(9)4-2/h4-7,11H,1-3H3;3-7H2,1-2H3 |
| InChIKey | NDLNUVGXSGXNBX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-propan-2-ylphenol;octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-propan-2-ylphenol;octan-3-one?
The IUPAC name of 5-methyl-2-propan-2-ylphenol;octan-3-one (CID 69043830) is 5-methyl-2-propan-2-ylphenol;octan-3-one.
What is the SMILES notation for 5-methyl-2-propan-2-ylphenol;octan-3-one?
The canonical SMILES for 5-methyl-2-propan-2-ylphenol;octan-3-one is CCCCCC(=O)CC.Cc1ccc(C(C)C)c(O)c1.
What is the InChIKey of 5-methyl-2-propan-2-ylphenol;octan-3-one?
The InChIKey is NDLNUVGXSGXNBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C8H16O/c1-7(2)9-5-4-8(3)6-10(9)11;1-3-5-6-7-8(9)4-2/h4-7,11H,1-3H3;3-7H2,1-2H3.
What are the key properties of 5-methyl-2-propan-2-ylphenol;octan-3-one?
5-methyl-2-propan-2-ylphenol;octan-3-one has a molecular weight of 278.44 g/mol, XLogP of 5.37, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-propan-2-ylphenol;octan-3-one is sourced from PubChem (CID 69043830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).