C30H55NO6 — CID 174668516
2-(dihydroxyamino)ethanol;5-methyl-2-propan-2-ylphenol;(Z)-octadec-9-enoic acid (PubChem CID 174668516) has the molecular formula C30H55NO6 and a molecular weight of 525.77 g/mol. Its IUPAC name is 2-(dihydroxyamino)ethanol;5-methyl-2-propan-2-ylphenol;(Z)-octadec-9-enoic acid.
| Compound Name | 2-(dihydroxyamino)ethanol;5-methyl-2-propan-2-ylphenol;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 174668516 |
| Molecular Formula | C30H55NO6 |
| Molecular Weight | 525.77 g/mol |
| Exact Mass | 525.40 |
| IUPAC Name | 2-(dihydroxyamino)ethanol;5-methyl-2-propan-2-ylphenol;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.Cc1ccc(C(C)C)c(O)c1.OCCN(O)O |
| InChI | InChI=1S/C18H34O2.C10H14O.C2H7NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-7(2)9-5-4-8(3)6-10(9)11;4-2-1-3(5)6/h9-10H,2-8,11-17H2,1H3,(H,19,20);4-7,11H,1-3H3;4-6H,1-2H2/b10-9-;; |
| InChIKey | GRQPNSHMPRMVQQ-XXAVUKJNSA-N |
| XLogP | 7.99 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.77 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|