About decan-1-ol;5-methyl-2-propan-2-ylphenol
decan-1-ol;5-methyl-2-propan-2-ylphenol (PubChem CID 158013264) has the molecular formula C20H36O2
and a molecular weight of 308.51 g/mol. Its IUPAC name is decan-1-ol;5-methyl-2-propan-2-ylphenol.
Molecular Properties
| Compound Name | decan-1-ol;5-methyl-2-propan-2-ylphenol |
| PubChem CID | 158013264 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | decan-1-ol;5-methyl-2-propan-2-ylphenol |
| SMILES | CCCCCCCCCCO.Cc1ccc(C(C)C)c(O)c1 |
| InChI | InChI=1S/C10H14O.C10H22O/c1-7(2)9-5-4-8(3)6-10(9)11;1-2-3-4-5-6-7-8-9-10-11/h4-7,11H,1-3H3;11H,2-10H2,1H3 |
| InChIKey | FFDRBZBJDCFAFC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decan-1-ol;5-methyl-2-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-1-ol;5-methyl-2-propan-2-ylphenol?
The IUPAC name of decan-1-ol;5-methyl-2-propan-2-ylphenol (CID 158013264) is decan-1-ol;5-methyl-2-propan-2-ylphenol.
What is the SMILES notation for decan-1-ol;5-methyl-2-propan-2-ylphenol?
The canonical SMILES for decan-1-ol;5-methyl-2-propan-2-ylphenol is CCCCCCCCCCO.Cc1ccc(C(C)C)c(O)c1.
What is the InChIKey of decan-1-ol;5-methyl-2-propan-2-ylphenol?
The InChIKey is FFDRBZBJDCFAFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C10H22O/c1-7(2)9-5-4-8(3)6-10(9)11;1-2-3-4-5-6-7-8-9-10-11/h4-7,11H,1-3H3;11H,2-10H2,1H3.
What are the key properties of decan-1-ol;5-methyl-2-propan-2-ylphenol?
decan-1-ol;5-methyl-2-propan-2-ylphenol has a molecular weight of 308.51 g/mol, XLogP of 5.94, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decan-1-ol;5-methyl-2-propan-2-ylphenol is sourced from PubChem (CID 158013264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).