About 5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol
5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol (PubChem CID 70210604) has the molecular formula C22H32O2
and a molecular weight of 328.50 g/mol. Its IUPAC name is 5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol.
Molecular Properties
| Compound Name | 5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol |
| PubChem CID | 70210604 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol |
| SMILES | CCCCCc1ccc(C)cc1O.Cc1cc(O)ccc1C(C)C |
| InChI | InChI=1S/C12H18O.C10H14O/c1-3-4-5-6-11-8-7-10(2)9-12(11)13;1-7(2)10-5-4-9(11)6-8(10)3/h7-9,13H,3-6H2,1-2H3;4-7,11H,1-3H3 |
| InChIKey | KZHMXWCJVAQSRH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol?
The IUPAC name of 5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol (CID 70210604) is 5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol.
What is the SMILES notation for 5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol?
The canonical SMILES for 5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol is CCCCCc1ccc(C)cc1O.Cc1cc(O)ccc1C(C)C.
What is the InChIKey of 5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol?
The InChIKey is KZHMXWCJVAQSRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O.C10H14O/c1-3-4-5-6-11-8-7-10(2)9-12(11)13;1-7(2)10-5-4-9(11)6-8(10)3/h7-9,13H,3-6H2,1-2H3;4-7,11H,1-3H3.
What are the key properties of 5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol?
5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol has a molecular weight of 328.50 g/mol, XLogP of 6.26, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-pentylphenol;3-methyl-4-propan-2-ylphenol is sourced from PubChem (CID 70210604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).