C12H22O — CID 143419778
2,5-dimethylphenol;ethane (PubChem CID 143419778) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 2,5-dimethylphenol;ethane.
| Compound Name | 2,5-dimethylphenol;ethane |
|---|---|
| PubChem CID | 143419778 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 2,5-dimethylphenol;ethane |
| SMILES | CC.CC.Cc1ccc(C)c(O)c1 |
| InChI | InChI=1S/C8H10O.2C2H6/c1-6-3-4-7(2)8(9)5-6;2*1-2/h3-5,9H,1-2H3;2*1-2H3 |
| InChIKey | HSBNOHVGROZRMX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |