About 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride
2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride (PubChem CID 173197082) has the molecular formula C16H21ClO2Zr
and a molecular weight of 372.02 g/mol. Its IUPAC name is 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride.
Molecular Properties
| Compound Name | 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride |
| PubChem CID | 173197082 |
| Molecular Formula | C16H21ClO2Zr |
| Molecular Weight | 372.02 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride |
| SMILES | Cc1ccc(C)c(O)c1.Cc1cccc(O)c1C.Cl.[Zr] |
| InChI | InChI=1S/2C8H10O.ClH.Zr/c1-6-3-4-7(2)8(9)5-6;1-6-4-3-5-8(9)7(6)2;;/h2*3-5,9H,1-2H3;1H; |
| InChIKey | LVWLVAYTELFCLU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.02 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride?
The IUPAC name of 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride (CID 173197082) is 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride.
What is the SMILES notation for 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride?
The canonical SMILES for 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride is Cc1ccc(C)c(O)c1.Cc1cccc(O)c1C.Cl.[Zr].
What is the InChIKey of 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride?
The InChIKey is LVWLVAYTELFCLU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H10O.ClH.Zr/c1-6-3-4-7(2)8(9)5-6;1-6-4-3-5-8(9)7(6)2;;/h2*3-5,9H,1-2H3;1H;.
What are the key properties of 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride?
2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride has a molecular weight of 372.02 g/mol, XLogP of 4.44, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride is sourced from PubChem (CID 173197082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).