C16H21ClO2Zr — CID 173197082
2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride (PubChem CID 173197082) has the molecular formula C16H21ClO2Zr and a molecular weight of 372.02 g/mol. Its IUPAC name is 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride.
| Compound Name | 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride |
|---|---|
| PubChem CID | 173197082 |
| Molecular Formula | C16H21ClO2Zr |
| Molecular Weight | 372.02 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 2,3-dimethylphenol;2,5-dimethylphenol;zirconium;hydrochloride |
| SMILES | Cc1ccc(C)c(O)c1.Cc1cccc(O)c1C.Cl.[Zr] |
| InChI | InChI=1S/2C8H10O.ClH.Zr/c1-6-3-4-7(2)8(9)5-6;1-6-4-3-5-8(9)7(6)2;;/h2*3-5,9H,1-2H3;1H; |
| InChIKey | LVWLVAYTELFCLU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.02 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |