About magnesium;benzene;4-methylbenzenesulfonic acid
magnesium;benzene;4-methylbenzenesulfonic acid (PubChem CID 173232116) has the molecular formula C13H13MgO3S+
and a molecular weight of 273.62 g/mol. Its IUPAC name is magnesium;benzene;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | magnesium;benzene;4-methylbenzenesulfonic acid |
| PubChem CID | 173232116 |
| Molecular Formula | C13H13MgO3S+ |
| Molecular Weight | 273.62 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | magnesium;benzene;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.[Mg+2].[c-]1ccccc1 |
| InChI | InChI=1S/C7H8O3S.C6H5.Mg/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-4-6-5-3-1;/h2-5H,1H3,(H,8,9,10);1-5H;/q;-1;+2 |
| InChIKey | XZXXQRGOMMUARK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.62 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze magnesium;benzene;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;benzene;4-methylbenzenesulfonic acid?
The IUPAC name of magnesium;benzene;4-methylbenzenesulfonic acid (CID 173232116) is magnesium;benzene;4-methylbenzenesulfonic acid.
What is the SMILES notation for magnesium;benzene;4-methylbenzenesulfonic acid?
The canonical SMILES for magnesium;benzene;4-methylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)cc1.[Mg+2].[c-]1ccccc1.
What is the InChIKey of magnesium;benzene;4-methylbenzenesulfonic acid?
The InChIKey is XZXXQRGOMMUARK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C6H5.Mg/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-4-6-5-3-1;/h2-5H,1H3,(H,8,9,10);1-5H;/q;-1;+2.
What are the key properties of magnesium;benzene;4-methylbenzenesulfonic acid?
magnesium;benzene;4-methylbenzenesulfonic acid has a molecular weight of 273.62 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;benzene;4-methylbenzenesulfonic acid is sourced from PubChem (CID 173232116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).