C14H15NO6 — CID 157213392
4-methylbenzene-1,2-diol;3,4,5-trihydroxybenzamide (PubChem CID 157213392) has the molecular formula C14H15NO6 and a molecular weight of 293.28 g/mol. Its IUPAC name is 4-methylbenzene-1,2-diol;3,4,5-trihydroxybenzamide.
| Compound Name | 4-methylbenzene-1,2-diol;3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 157213392 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 4-methylbenzene-1,2-diol;3,4,5-trihydroxybenzamide |
| SMILES | Cc1ccc(O)c(O)c1.NC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C7H7NO4.C7H8O2/c8-7(12)3-1-4(9)6(11)5(10)2-3;1-5-2-3-6(8)7(9)4-5/h1-2,9-11H,(H2,8,12);2-4,8-9H,1H3 |
| InChIKey | ASDIYVPXYQCZHD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|