C14H12O6 — CID 90791517
(2-hydroxy-5-methylphenyl) 3,4,5-trihydroxybenzoate (PubChem CID 90791517) has the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. Its IUPAC name is (2-hydroxy-5-methylphenyl) 3,4,5-trihydroxybenzoate.
| Compound Name | (2-hydroxy-5-methylphenyl) 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 90791517 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (2-hydroxy-5-methylphenyl) 3,4,5-trihydroxybenzoate |
| SMILES | Cc1ccc(O)c(OC(=O)c2cc(O)c(O)c(O)c2)c1 |
| InChI | InChI=1S/C14H12O6/c1-7-2-3-9(15)12(4-7)20-14(19)8-5-10(16)13(18)11(17)6-8/h2-6,15-18H,1H3 |
| InChIKey | YRQRRRVXJPMYSM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|