C28H21O16- — CID 54728055
4-carboxy-2,6-dihydroxyphenolate;[5-(2,3-dihydroxy-5-methylphenoxy)carbonyl-2,3-dihydroxyphenyl] 3,4,5-trihydroxybenzoate (PubChem CID 54728055) has the molecular formula C28H21O16- and a molecular weight of 613.46 g/mol. Its IUPAC name is 4-carboxy-2,6-dihydroxyphenolate;[5-(2,3-dihydroxy-5-methylphenoxy)carbonyl-2,3-dihydroxyphenyl] 3,4,5-trihydroxybenzoate.
| Compound Name | 4-carboxy-2,6-dihydroxyphenolate;[5-(2,3-dihydroxy-5-methylphenoxy)carbonyl-2,3-dihydroxyphenyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 54728055 |
| Molecular Formula | C28H21O16- |
| Molecular Weight | 613.46 g/mol |
| Exact Mass | 613.08 |
| IUPAC Name | 4-carboxy-2,6-dihydroxyphenolate;[5-(2,3-dihydroxy-5-methylphenoxy)carbonyl-2,3-dihydroxyphenyl] 3,4,5-trihydroxybenzoate |
| SMILES | Cc1cc(O)c(O)c(OC(=O)c2cc(O)c(O)c(OC(=O)c3cc(O)c(O)c(O)c3)c2)c1.O=C(O)c1cc(O)c([O-])c(O)c1 |
| InChI | InChI=1S/C21H16O11.C7H6O5/c1-8-2-11(22)18(27)15(3-8)31-21(30)10-6-14(25)19(28)16(7-10)32-20(29)9-4-12(23)17(26)13(24)5-9;8-4-1-3(7(11)12)2-5(9)6(4)10/h2-7,22-28H,1H3;1-2,8-10H,(H,11,12)/p-1 |
| InChIKey | ONNAWXHTRXVHIR-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 295.03 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|