C15H12O8 — CID 162952851
3-hydroxy-5-methyl-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid (PubChem CID 162952851) has the molecular formula C15H12O8 and a molecular weight of 320.25 g/mol. Its IUPAC name is 3-hydroxy-5-methyl-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid.
| Compound Name | 3-hydroxy-5-methyl-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid |
|---|---|
| PubChem CID | 162952851 |
| Molecular Formula | C15H12O8 |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3-hydroxy-5-methyl-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(O)c1OC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C15H12O8/c1-6-2-7(14(20)21)3-11(18)13(6)23-15(22)8-4-9(16)12(19)10(17)5-8/h2-5,16-19H,1H3,(H,20,21) |
| InChIKey | PPAPWJFTNNEWSW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|