C17H18O8 — CID 167592222
(5-acetyl-2,3-dihydroxyphenyl) 3,4,5-trihydroxybenzoate;ethane (PubChem CID 167592222) has the molecular formula C17H18O8 and a molecular weight of 350.32 g/mol. Its IUPAC name is (5-acetyl-2,3-dihydroxyphenyl) 3,4,5-trihydroxybenzoate;ethane.
| Compound Name | (5-acetyl-2,3-dihydroxyphenyl) 3,4,5-trihydroxybenzoate;ethane |
|---|---|
| PubChem CID | 167592222 |
| Molecular Formula | C17H18O8 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (5-acetyl-2,3-dihydroxyphenyl) 3,4,5-trihydroxybenzoate;ethane |
| SMILES | CC.CC(=O)c1cc(O)c(O)c(OC(=O)c2cc(O)c(O)c(O)c2)c1 |
| InChI | InChI=1S/C15H12O8.C2H6/c1-6(16)7-2-11(19)14(21)12(5-7)23-15(22)8-3-9(17)13(20)10(18)4-8;1-2/h2-5,17-21H,1H3;1-2H3 |
| InChIKey | IOSPVHVZERKZHK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|