C15H14O7 — CID 175496611
(2,3-dimethoxyphenyl) 3,4,5-trihydroxybenzoate (PubChem CID 175496611) has the molecular formula C15H14O7 and a molecular weight of 306.27 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl) 3,4,5-trihydroxybenzoate.
| Compound Name | (2,3-dimethoxyphenyl) 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 175496611 |
| Molecular Formula | C15H14O7 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (2,3-dimethoxyphenyl) 3,4,5-trihydroxybenzoate |
| SMILES | COc1cccc(OC(=O)c2cc(O)c(O)c(O)c2)c1OC |
| InChI | InChI=1S/C15H14O7/c1-20-11-4-3-5-12(14(11)21-2)22-15(19)8-6-9(16)13(18)10(17)7-8/h3-7,16-18H,1-2H3 |
| InChIKey | JVUKNNAJIMEREK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|