C42H32O12 — CID 10509131
[26,28-dihydroxy-27-(3,4,5-trihydroxybenzoyl)oxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl] 3,4,5-trihydroxybenzoate (PubChem CID 10509131) has the molecular formula C42H32O12 and a molecular weight of 728.71 g/mol. Its IUPAC name is [26,28-dihydroxy-27-(3,4,5-trihydroxybenzoyl)oxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [26,28-dihydroxy-27-(3,4,5-trihydroxybenzoyl)oxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 10509131 |
| Molecular Formula | C42H32O12 |
| Molecular Weight | 728.71 g/mol |
| Exact Mass | 728.19 |
| IUPAC Name | [26,28-dihydroxy-27-(3,4,5-trihydroxybenzoyl)oxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(Oc1c2cccc1Cc1cccc(c1O)Cc1cccc(c1OC(=O)c1cc(O)c(O)c(O)c1)Cc1cccc(c1O)C2)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C42H32O12/c43-31-17-29(18-32(44)37(31)49)41(51)53-39-25-9-3-11-27(39)15-23-7-2-8-24(36(23)48)16-28-12-4-10-26(14-22-6-1-5-21(13-25)35(22)47)40(28)54-42(52)30-19-33(45)38(50)34(46)20-30/h1-12,17-20,43-50H,13-16H2 |
| InChIKey | OFXSMEJBQCAMKX-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 214.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.71 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|